C9H5F5N4 — CID 87664913
5-(1,1,2,2,2-pentafluoroethyl)-1-phenyltetrazole (PubChem CID 87664913) has the molecular formula C9H5F5N4 and a molecular weight of 264.16 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1-phenyltetrazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1-phenyltetrazole |
|---|---|
| PubChem CID | 87664913 |
| Molecular Formula | C9H5F5N4 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1-phenyltetrazole |
| SMILES | FC(F)(F)C(F)(F)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C9H5F5N4/c10-8(11,9(12,13)14)7-15-16-17-18(7)6-4-2-1-3-5-6/h1-5H |
| InChIKey | UYTDVGSWARZODN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|