C6H7F2NO — CID 69033111
(4R)-4-[(Z)-1,2-difluoroethenyl]pyrrolidin-2-one (PubChem CID 69033111) has the molecular formula C6H7F2NO and a molecular weight of 147.12 g/mol. Its IUPAC name is (4R)-4-[(Z)-1,2-difluoroethenyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[(Z)-1,2-difluoroethenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69033111 |
| Molecular Formula | C6H7F2NO |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (4R)-4-[(Z)-1,2-difluoroethenyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@@H](/C(F)=C/F)CN1 |
| InChI | InChI=1S/C6H7F2NO/c7-2-5(8)4-1-6(10)9-3-4/h2,4H,1,3H2,(H,9,10)/b5-2-/t4-/m1/s1 |
| InChIKey | RYRWUTZVYDUWQG-PLSQTASKSA-N |
| XLogP | 0.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |