C14H16ClN3O5S — CID 69033386
methyl 1-[(3-chloro-4-cyano-2-methylphenyl)sulfamoyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 69033386) has the molecular formula C14H16ClN3O5S and a molecular weight of 373.82 g/mol. Its IUPAC name is methyl 1-[(3-chloro-4-cyano-2-methylphenyl)sulfamoyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(3-chloro-4-cyano-2-methylphenyl)sulfamoyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 69033386 |
| Molecular Formula | C14H16ClN3O5S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | methyl 1-[(3-chloro-4-cyano-2-methylphenyl)sulfamoyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1S(=O)(=O)Nc1ccc(C#N)c(Cl)c1C |
| InChI | InChI=1S/C14H16ClN3O5S/c1-8-11(4-3-9(6-16)13(8)15)17-24(21,22)18-7-10(19)5-12(18)14(20)23-2/h3-4,10,12,17,19H,5,7H2,1-2H3 |
| InChIKey | VHPMOSNDRKFFNS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |