C10H10N4 — CID 69036391
1,5-dihydropyrrolo[2,3-f]indole-3,7-diamine (PubChem CID 69036391) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 1,5-dihydropyrrolo[2,3-f]indole-3,7-diamine.
| Compound Name | 1,5-dihydropyrrolo[2,3-f]indole-3,7-diamine |
|---|---|
| PubChem CID | 69036391 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,5-dihydropyrrolo[2,3-f]indole-3,7-diamine |
| SMILES | Nc1c[nH]c2cc3c(N)c[nH]c3cc12 |
| InChI | InChI=1S/C10H10N4/c11-7-3-14-10-2-6-8(12)4-13-9(6)1-5(7)10/h1-4,13-14H,11-12H2 |
| InChIKey | SERVRMKOLXJVEO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |