C12H14N2 — CID 69037485
5-methyl-4-[(3-methylphenyl)methyl]-1H-pyrazole (PubChem CID 69037485) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 5-methyl-4-[(3-methylphenyl)methyl]-1H-pyrazole.
| Compound Name | 5-methyl-4-[(3-methylphenyl)methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 69037485 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 5-methyl-4-[(3-methylphenyl)methyl]-1H-pyrazole |
| SMILES | Cc1cccc(Cc2cn[nH]c2C)c1 |
| InChI | InChI=1S/C12H14N2/c1-9-4-3-5-11(6-9)7-12-8-13-14-10(12)2/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | UCSQRNLNOLSFAM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |