C17H17N5O4 — CID 69038949
4-[3-(2-methoxyethylcarbamoyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxylic acid (PubChem CID 69038949) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[3-(2-methoxyethylcarbamoyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxylic acid.
| Compound Name | 4-[3-(2-methoxyethylcarbamoyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxylic acid |
|---|---|
| PubChem CID | 69038949 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-[3-(2-methoxyethylcarbamoyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxylic acid |
| SMILES | COCCNC(=O)c1cccc(Nc2ncnc3c2ccn3C(=O)O)c1 |
| InChI | InChI=1S/C17H17N5O4/c1-26-8-6-18-16(23)11-3-2-4-12(9-11)21-14-13-5-7-22(17(24)25)15(13)20-10-19-14/h2-5,7,9-10H,6,8H2,1H3,(H,18,23)(H,24,25)(H,19,20,21) |
| InChIKey | FJKIUFUZYZDWST-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|