C18H18N4O3 — CID 66813522
1-(2-methoxyethyl)-3-[3-(pyrrolo[2,3-b]pyridine-1-carbonyl)phenyl]urea (PubChem CID 66813522) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[3-(pyrrolo[2,3-b]pyridine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(2-methoxyethyl)-3-[3-(pyrrolo[2,3-b]pyridine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 66813522 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[3-(pyrrolo[2,3-b]pyridine-1-carbonyl)phenyl]urea |
| SMILES | COCCNC(=O)Nc1cccc(C(=O)n2ccc3cccnc32)c1 |
| InChI | InChI=1S/C18H18N4O3/c1-25-11-9-20-18(24)21-15-6-2-4-14(12-15)17(23)22-10-7-13-5-3-8-19-16(13)22/h2-8,10,12H,9,11H2,1H3,(H2,20,21,24) |
| InChIKey | BJIDGPHQBODSSP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|