C21H30ClN3O3 — CID 69039631
tert-butyl N-[(3-chlorophenyl)-[4-(2-oxoimidazolidin-1-yl)cyclohexyl]methyl]carbamate (PubChem CID 69039631) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is tert-butyl N-[(3-chlorophenyl)-[4-(2-oxoimidazolidin-1-yl)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[(3-chlorophenyl)-[4-(2-oxoimidazolidin-1-yl)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 69039631 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl N-[(3-chlorophenyl)-[4-(2-oxoimidazolidin-1-yl)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1cccc(Cl)c1)C1CCC(N2CCNC2=O)CC1 |
| InChI | InChI=1S/C21H30ClN3O3/c1-21(2,3)28-20(27)24-18(15-5-4-6-16(22)13-15)14-7-9-17(10-8-14)25-12-11-23-19(25)26/h4-6,13-14,17-18H,7-12H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | NGJWLNGRAHVJCI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |