C26H29ClN2O4 — CID 71184441
tert-butyl N-[(3-chlorophenyl)-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]methyl]carbamate (PubChem CID 71184441) has the molecular formula C26H29ClN2O4 and a molecular weight of 468.98 g/mol. Its IUPAC name is tert-butyl N-[(3-chlorophenyl)-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[(3-chlorophenyl)-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 71184441 |
| Molecular Formula | C26H29ClN2O4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | tert-butyl N-[(3-chlorophenyl)-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1cccc(Cl)c1)C1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C26H29ClN2O4/c1-26(2,3)33-25(32)28-22(17-7-6-8-18(27)15-17)16-11-13-19(14-12-16)29-23(30)20-9-4-5-10-21(20)24(29)31/h4-10,15-16,19,22H,11-14H2,1-3H3,(H,28,32) |
| InChIKey | RTOINCIEAFPBKC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|