C24H28N4O2 — CID 69041807
benzyl 3-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]-2H-indazole-4-carboxylate (PubChem CID 69041807) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is benzyl 3-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]-2H-indazole-4-carboxylate.
| Compound Name | benzyl 3-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]-2H-indazole-4-carboxylate |
|---|---|
| PubChem CID | 69041807 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | benzyl 3-[2-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]-2H-indazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cccc2n[nH]c(CCNC3CN4CCC3CC4)c12 |
| InChI | InChI=1S/C24H28N4O2/c29-24(30-16-17-5-2-1-3-6-17)19-7-4-8-20-23(19)21(27-26-20)9-12-25-22-15-28-13-10-18(22)11-14-28/h1-8,18,22,25H,9-16H2,(H,26,27) |
| InChIKey | VEWRMILQJMLQSL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |