C14H19ClN2O5S — CID 69042968
tert-butyl [3-[(5-chlorothiophene-2-carbonyl)amino]-4-hydroxypyrrolidin-1-yl] carbonate (PubChem CID 69042968) has the molecular formula C14H19ClN2O5S and a molecular weight of 362.84 g/mol. Its IUPAC name is tert-butyl [3-[(5-chlorothiophene-2-carbonyl)amino]-4-hydroxypyrrolidin-1-yl] carbonate.
| Compound Name | tert-butyl [3-[(5-chlorothiophene-2-carbonyl)amino]-4-hydroxypyrrolidin-1-yl] carbonate |
|---|---|
| PubChem CID | 69042968 |
| Molecular Formula | C14H19ClN2O5S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | tert-butyl [3-[(5-chlorothiophene-2-carbonyl)amino]-4-hydroxypyrrolidin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CC(O)C(NC(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C14H19ClN2O5S/c1-14(2,3)21-13(20)22-17-6-8(9(18)7-17)16-12(19)10-4-5-11(15)23-10/h4-5,8-9,18H,6-7H2,1-3H3,(H,16,19) |
| InChIKey | BSCTWTCYEOYUFW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |