C15H21ClN2O4S — CID 140549092
butyl 3-[(5-chlorothiophene-2-carbonyl)amino]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 140549092) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is butyl 3-[(5-chlorothiophene-2-carbonyl)amino]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | butyl 3-[(5-chlorothiophene-2-carbonyl)amino]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140549092 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | butyl 3-[(5-chlorothiophene-2-carbonyl)amino]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC(NC(=O)c2ccc(Cl)s2)C(OC)C1 |
| InChI | InChI=1S/C15H21ClN2O4S/c1-3-4-7-22-15(20)18-8-10(11(9-18)21-2)17-14(19)12-5-6-13(16)23-12/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,17,19) |
| InChIKey | XHDRCKGIVFKVCW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|