C18H22ClN5O3S2 — CID 86608843
5-chloro-N-[(3S,4S)-4-methoxy-1-[2-oxo-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 86608843) has the molecular formula C18H22ClN5O3S2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 5-chloro-N-[(3S,4S)-4-methoxy-1-[2-oxo-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(3S,4S)-4-methoxy-1-[2-oxo-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86608843 |
| Molecular Formula | C18H22ClN5O3S2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-chloro-N-[(3S,4S)-4-methoxy-1-[2-oxo-2-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-b]pyridin-2-ylamino)ethyl]pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | CO[C@H]1CN(CC(=O)Nc2nc3c(s2)CCCN3)C[C@@H]1NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H22ClN5O3S2/c1-27-11-8-24(7-10(11)21-17(26)13-4-5-14(19)28-13)9-15(25)22-18-23-16-12(29-18)3-2-6-20-16/h4-5,10-11,20H,2-3,6-9H2,1H3,(H,21,26)(H,22,23,25)/t10-,11-/m0/s1 |
| InChIKey | ZXNPFMNVHSRGMR-QWRGUYRKSA-N |
| XLogP | 2.28 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |