C18H26ClN3O5S — CID 91278257
butyl (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-2-(ethylcarbamoyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 91278257) has the molecular formula C18H26ClN3O5S and a molecular weight of 431.94 g/mol. Its IUPAC name is butyl (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-2-(ethylcarbamoyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | butyl (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-2-(ethylcarbamoyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91278257 |
| Molecular Formula | C18H26ClN3O5S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | butyl (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-2-(ethylcarbamoyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](NC(=O)c2ccc(Cl)s2)C[C@H]1COC(=O)NCC |
| InChI | InChI=1S/C18H26ClN3O5S/c1-3-5-8-26-18(25)22-10-12(9-13(22)11-27-17(24)20-4-2)21-16(23)14-6-7-15(19)28-14/h6-7,12-13H,3-5,8-11H2,1-2H3,(H,20,24)(H,21,23)/t12-,13+/m1/s1 |
| InChIKey | IMXZZNSSYUBOOE-OLZOCXBDSA-N |
| XLogP | 3.26 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|