C15H22ClN3O3S — CID 90952897
butyl (2S,4R)-2-(aminomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 90952897) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is butyl (2S,4R)-2-(aminomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | butyl (2S,4R)-2-(aminomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90952897 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | butyl (2S,4R)-2-(aminomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](NC(=O)c2ccc(Cl)s2)C[C@H]1CN |
| InChI | InChI=1S/C15H22ClN3O3S/c1-2-3-6-22-15(21)19-9-10(7-11(19)8-17)18-14(20)12-4-5-13(16)23-12/h4-5,10-11H,2-3,6-9,17H2,1H3,(H,18,20)/t10-,11+/m1/s1 |
| InChIKey | UAMLDEIOKONUIW-MNOVXSKESA-N |
| XLogP | 2.47 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|