C21H29ClN4O2S3 — CID 145481294
N-[(3R,5S)-5-(aminomethyl)-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-3-yl]-5-chlorothiophene-2-carboxamide;methanethiol (PubChem CID 145481294) has the molecular formula C21H29ClN4O2S3 and a molecular weight of 501.14 g/mol. Its IUPAC name is N-[(3R,5S)-5-(aminomethyl)-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-3-yl]-5-chlorothiophene-2-carboxamide;methanethiol.
| Compound Name | N-[(3R,5S)-5-(aminomethyl)-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-3-yl]-5-chlorothiophene-2-carboxamide;methanethiol |
|---|---|
| PubChem CID | 145481294 |
| Molecular Formula | C21H29ClN4O2S3 |
| Molecular Weight | 501.14 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-[(3R,5S)-5-(aminomethyl)-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-3-yl]-5-chlorothiophene-2-carboxamide;methanethiol |
| SMILES | CN1CCc2cc(C(=O)N3C[C@H](NC(=O)c4ccc(Cl)s4)C[C@H]3CN)sc2CC1.CS |
| InChI | InChI=1S/C20H25ClN4O2S2.CH4S/c1-24-6-4-12-8-17(28-15(12)5-7-24)20(27)25-11-13(9-14(25)10-22)23-19(26)16-2-3-18(21)29-16;1-2/h2-3,8,13-14H,4-7,9-11,22H2,1H3,(H,23,26);2H,1H3/t13-,14+;/m1./s1 |
| InChIKey | RZYBCRUNSQIQKG-DFQHDRSWSA-N |
| XLogP | 3.01 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|