C21H24ClN3O5S2 — CID 150209901
(2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-[(4S)-4-methoxy-6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 150209901) has the molecular formula C21H24ClN3O5S2 and a molecular weight of 498.03 g/mol. Its IUPAC name is (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-[(4S)-4-methoxy-6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-[(4S)-4-methoxy-6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 150209901 |
| Molecular Formula | C21H24ClN3O5S2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | (2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-[(4S)-4-methoxy-6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CO[C@@H]1CN(C)CCc2sc(C(=O)N3C[C@H](NC(=O)c4ccc(Cl)s4)C[C@H]3C(=O)O)cc21 |
| InChI | InChI=1S/C21H24ClN3O5S2/c1-24-6-5-15-12(14(10-24)30-2)8-17(31-15)20(27)25-9-11(7-13(25)21(28)29)23-19(26)16-3-4-18(22)32-16/h3-4,8,11,13-14H,5-7,9-10H2,1-2H3,(H,23,26)(H,28,29)/t11-,13+,14-/m1/s1 |
| InChIKey | FRGMFUYJWJLTCU-KWCYVHTRSA-N |
| XLogP | 2.74 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |