C22H27ClN4O5S2 — CID 70893754
[(2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-2-yl] N-(methoxymethyl)carbamate (PubChem CID 70893754) has the molecular formula C22H27ClN4O5S2 and a molecular weight of 527.07 g/mol. Its IUPAC name is [(2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-2-yl] N-(methoxymethyl)carbamate.
| Compound Name | [(2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-2-yl] N-(methoxymethyl)carbamate |
|---|---|
| PubChem CID | 70893754 |
| Molecular Formula | C22H27ClN4O5S2 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [(2S,4R)-4-[(5-chlorothiophene-2-carbonyl)amino]-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidin-2-yl] N-(methoxymethyl)carbamate |
| SMILES | COCNC(=O)O[C@H]1C[C@@H](NC(=O)c2ccc(Cl)s2)CN1C(=O)c1cc2c(s1)CCN(C)CC2 |
| InChI | InChI=1S/C22H27ClN4O5S2/c1-26-7-5-13-9-17(33-15(13)6-8-26)21(29)27-11-14(10-19(27)32-22(30)24-12-31-2)25-20(28)16-3-4-18(23)34-16/h3-4,9,14,19H,5-8,10-12H2,1-2H3,(H,24,30)(H,25,28)/t14-,19+/m1/s1 |
| InChIKey | ACFTXRQBXAVTNL-KUHUBIRLSA-N |
| XLogP | 2.79 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|