C21H27ClN4O3S2 — CID 71055956
(2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 71055956) has the molecular formula C21H27ClN4O3S2 and a molecular weight of 483.06 g/mol. Its IUPAC name is (2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71055956 |
| Molecular Formula | C21H27ClN4O3S2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | (2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](NC(=O)C2CC=C(Cl)S2)CN1C(=O)c1cc2c(s1)CCN(C)CC2 |
| InChI | InChI=1S/C21H27ClN4O3S2/c1-23-19(27)14-10-13(24-20(28)16-3-4-18(22)31-16)11-26(14)21(29)17-9-12-5-7-25(2)8-6-15(12)30-17/h4,9,13-14,16H,3,5-8,10-11H2,1-2H3,(H,23,27)(H,24,28)/t13-,14+,16?/m1/s1 |
| InChIKey | JIAGARXIBBAYOX-CNYCQXTOSA-N |
| XLogP | 1.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |