C15H20ClN5O3S — CID 91175422
butyl (2S,4R)-2-(azidomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 91175422) has the molecular formula C15H20ClN5O3S and a molecular weight of 385.88 g/mol. Its IUPAC name is butyl (2S,4R)-2-(azidomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | butyl (2S,4R)-2-(azidomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91175422 |
| Molecular Formula | C15H20ClN5O3S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | butyl (2S,4R)-2-(azidomethyl)-4-[(5-chlorothiophene-2-carbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](NC(=O)c2ccc(Cl)s2)C[C@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C15H20ClN5O3S/c1-2-3-6-24-15(23)21-9-10(7-11(21)8-18-20-17)19-14(22)12-4-5-13(16)25-12/h4-5,10-11H,2-3,6-9H2,1H3,(H,19,22)/t10-,11+/m1/s1 |
| InChIKey | GNNNEGNCPLUOIY-MNOVXSKESA-N |
| XLogP | 3.82 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|