C28H27FINO6 — CID 69043715
(2R,5R)-3-benzyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-(hydroxymethyl)-3-iodo-2-methoxycarbonylpyrrolidine-1-carboxylic acid (PubChem CID 69043715) has the molecular formula C28H27FINO6 and a molecular weight of 619.43 g/mol. Its IUPAC name is (2R,5R)-3-benzyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-(hydroxymethyl)-3-iodo-2-methoxycarbonylpyrrolidine-1-carboxylic acid.
| Compound Name | (2R,5R)-3-benzyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-(hydroxymethyl)-3-iodo-2-methoxycarbonylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69043715 |
| Molecular Formula | C28H27FINO6 |
| Molecular Weight | 619.43 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | (2R,5R)-3-benzyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-(hydroxymethyl)-3-iodo-2-methoxycarbonylpyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)[C@@]1(CO)N(C(=O)O)[C@@H](c2ccc(OCc3ccccc3F)cc2)CC1(I)Cc1ccccc1 |
| InChI | InChI=1S/C28H27FINO6/c1-36-25(33)28(18-32)27(30,15-19-7-3-2-4-8-19)16-24(31(28)26(34)35)20-11-13-22(14-12-20)37-17-21-9-5-6-10-23(21)29/h2-14,24,32H,15-18H2,1H3,(H,34,35)/t24-,27?,28-/m1/s1 |
| InChIKey | YDVYTDOILSXEGT-KPEOJYHJSA-N |
| XLogP | 5.15 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|