C34H39NO7Se — CID 58773481
2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 58773481) has the molecular formula C34H39NO7Se and a molecular weight of 652.65 g/mol. Its IUPAC name is 2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | 2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 58773481 |
| Molecular Formula | C34H39NO7Se |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 653.19 |
| IUPAC Name | 2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | COc1ccc(CN2C(=O)[C@H](CCO)[C@@H](C[Se]c3ccccc3)[C@]2(C(=O)OCc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H39NO7Se/c1-33(2,3)42-32(39)34(31(38)41-22-25-11-7-5-8-12-25)29(23-43-27-13-9-6-10-14-27)28(19-20-36)30(37)35(34)21-24-15-17-26(40-4)18-16-24/h5-18,28-29,36H,19-23H2,1-4H3/t28-,29-,34+/m1/s1 |
| InChIKey | NYTRGMDUKMXPAF-NDTJGYMGSA-N |
| XLogP | 3.92 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|