C28H31NO7 — CID 11375322
2-O-benzyl 2-O'-tert-butyl (2S,4R)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 11375322) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is 2-O-benzyl 2-O'-tert-butyl (2S,4R)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | 2-O-benzyl 2-O'-tert-butyl (2S,4R)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11375322 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-O-benzyl 2-O'-tert-butyl (2S,4R)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | C=C1[C@@H](CC=O)C(=O)N(Cc2ccc(OC)cc2)[C@@]1(C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H31NO7/c1-19-23(15-16-30)24(31)29(17-20-11-13-22(34-5)14-12-20)28(19,26(33)36-27(2,3)4)25(32)35-18-21-9-7-6-8-10-21/h6-14,16,23H,1,15,17-18H2,2-5H3/t23-,28+/m1/s1 |
| InChIKey | DHTPERHJPUEYSZ-LXFBAYGMSA-N |
| XLogP | 3.62 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|