C24H29NO6 — CID 11396219
methyl (2R,3R)-3-hydroxy-2-[(4-methoxyphenyl)methyl-prop-2-enoylamino]-2-(phenylmethoxymethyl)butanoate (PubChem CID 11396219) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl (2R,3R)-3-hydroxy-2-[(4-methoxyphenyl)methyl-prop-2-enoylamino]-2-(phenylmethoxymethyl)butanoate.
| Compound Name | methyl (2R,3R)-3-hydroxy-2-[(4-methoxyphenyl)methyl-prop-2-enoylamino]-2-(phenylmethoxymethyl)butanoate |
|---|---|
| PubChem CID | 11396219 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | methyl (2R,3R)-3-hydroxy-2-[(4-methoxyphenyl)methyl-prop-2-enoylamino]-2-(phenylmethoxymethyl)butanoate |
| SMILES | C=CC(=O)N(Cc1ccc(OC)cc1)[C@@](COCc1ccccc1)(C(=O)OC)[C@@H](C)O |
| InChI | InChI=1S/C24H29NO6/c1-5-22(27)25(15-19-11-13-21(29-3)14-12-19)24(18(2)26,23(28)30-4)17-31-16-20-9-7-6-8-10-20/h5-14,18,26H,1,15-17H2,2-4H3/t18-,24-/m1/s1 |
| InChIKey | JNISWLLWAKWUFV-HOYKHHGWSA-N |
| XLogP | 2.72 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|