C41H43NO8Se — CID 11170176
6-O-benzyl 6-O'-tert-butyl (3aR,6S,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate (PubChem CID 11170176) has the molecular formula C41H43NO8Se and a molecular weight of 756.75 g/mol. Its IUPAC name is 6-O-benzyl 6-O'-tert-butyl (3aR,6S,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate.
| Compound Name | 6-O-benzyl 6-O'-tert-butyl (3aR,6S,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11170176 |
| Molecular Formula | C41H43NO8Se |
| Molecular Weight | 756.75 g/mol |
| Exact Mass | 757.22 |
| IUPAC Name | 6-O-benzyl 6-O'-tert-butyl (3aR,6S,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate |
| SMILES | COc1ccc(CN2C(=O)[C@@H]3CC(OCc4ccccc4)O[C@]3(C[Se]c3ccccc3)[C@]2(C(=O)OCc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C41H43NO8Se/c1-39(2,3)50-38(45)41(37(44)48-27-31-16-10-6-11-17-31)40(28-51-33-18-12-7-13-19-33)34(24-35(49-40)47-26-30-14-8-5-9-15-30)36(43)42(41)25-29-20-22-32(46-4)23-21-29/h5-23,34-35H,24-28H2,1-4H3/t34-,35?,40-,41-/m0/s1 |
| InChIKey | GZDIOYVSYGHNSE-ZZHLCCNGSA-N |
| XLogP | 5.63 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|