C25H27NO7 — CID 25053793
methyl (2R,3aR,6S,6aS)-6-formyl-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate (PubChem CID 25053793) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is methyl (2R,3aR,6S,6aS)-6-formyl-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate.
| Compound Name | methyl (2R,3aR,6S,6aS)-6-formyl-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 25053793 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | methyl (2R,3aR,6S,6aS)-6-formyl-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate |
| SMILES | COC(=O)[C@]1(C=O)N(Cc2ccc(OC)cc2)C(=O)[C@@H]2C[C@H](OCc3ccccc3)O[C@@]21C |
| InChI | InChI=1S/C25H27NO7/c1-24-20(13-21(33-24)32-15-18-7-5-4-6-8-18)22(28)26(25(24,16-27)23(29)31-3)14-17-9-11-19(30-2)12-10-17/h4-12,16,20-21H,13-15H2,1-3H3/t20-,21+,24-,25-/m0/s1 |
| InChIKey | JGFNJADYQMBDDL-JQOLTRQRSA-N |
| XLogP | 2.49 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|