C21H27NO7 — CID 11188920
tert-butyl (3R,3aR,6aS)-3-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate (PubChem CID 11188920) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6aS)-3-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6aS)-3-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 11188920 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl (3R,3aR,6aS)-3-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate |
| SMILES | COc1ccc(CN2C(=O)[C@H](CCO)[C@H]3COC(=O)[C@]32C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27NO7/c1-20(2,3)29-19(26)21-16(12-28-18(21)25)15(9-10-23)17(24)22(21)11-13-5-7-14(27-4)8-6-13/h5-8,15-16,23H,9-12H2,1-4H3/t15-,16-,21+/m1/s1 |
| InChIKey | IYBFSEFXOAARRL-ZOCZFRKYSA-N |
| XLogP | 1.29 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|