C32H33NO8Se — CID 25053792
dimethyl (2R,3aR,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate (PubChem CID 25053792) has the molecular formula C32H33NO8Se and a molecular weight of 638.58 g/mol. Its IUPAC name is dimethyl (2R,3aR,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate.
| Compound Name | dimethyl (2R,3aR,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 25053792 |
| Molecular Formula | C32H33NO8Se |
| Molecular Weight | 638.58 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | dimethyl (2R,3aR,6aS)-5-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylmethoxy-6a-(phenylselanylmethyl)-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)N(Cc2ccc(OC)cc2)C(=O)[C@@H]2C[C@H](OCc3ccccc3)O[C@@]21C[Se]c1ccccc1 |
| InChI | InChI=1S/C32H33NO8Se/c1-37-24-16-14-22(15-17-24)19-33-28(34)26-18-27(40-20-23-10-6-4-7-11-23)41-31(26,21-42-25-12-8-5-9-13-25)32(33,29(35)38-2)30(36)39-3/h4-17,26-27H,18-21H2,1-3H3/t26-,27+,31-/m0/s1 |
| InChIKey | YLPNKQWJXYSROI-PZXMZKPCSA-N |
| XLogP | 2.89 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|