C16H20ClN5O2S — CID 69045593
N-[1-[5-chloro-4-(5-methyl-2-pyridinyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide (PubChem CID 69045593) has the molecular formula C16H20ClN5O2S and a molecular weight of 381.89 g/mol. Its IUPAC name is N-[1-[5-chloro-4-(5-methyl-2-pyridinyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[5-chloro-4-(5-methyl-2-pyridinyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 69045593 |
| Molecular Formula | C16H20ClN5O2S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[1-[5-chloro-4-(5-methyl-2-pyridinyl)pyrimidin-2-yl]piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1ccc(-c2nc(N3CCC(NS(C)(=O)=O)CC3)ncc2Cl)nc1 |
| InChI | InChI=1S/C16H20ClN5O2S/c1-11-3-4-14(18-9-11)15-13(17)10-19-16(20-15)22-7-5-12(6-8-22)21-25(2,23)24/h3-4,9-10,12,21H,5-8H2,1-2H3 |
| InChIKey | BDNGRZRQJSFVDU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |