C17H14F2N2O2S — CID 69046746
5-amino-N-[(3,4-difluorophenyl)methyl]naphthalene-1-sulfonamide (PubChem CID 69046746) has the molecular formula C17H14F2N2O2S and a molecular weight of 348.37 g/mol. Its IUPAC name is 5-amino-N-[(3,4-difluorophenyl)methyl]naphthalene-1-sulfonamide.
| Compound Name | 5-amino-N-[(3,4-difluorophenyl)methyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 69046746 |
| Molecular Formula | C17H14F2N2O2S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 5-amino-N-[(3,4-difluorophenyl)methyl]naphthalene-1-sulfonamide |
| SMILES | Nc1cccc2c(S(=O)(=O)NCc3ccc(F)c(F)c3)cccc12 |
| InChI | InChI=1S/C17H14F2N2O2S/c18-14-8-7-11(9-15(14)19)10-21-24(22,23)17-6-2-3-12-13(17)4-1-5-16(12)20/h1-9,21H,10,20H2 |
| InChIKey | LVEGDPGJYPOYLF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|