C21H24N2O2S — CID 69050845
5-amino-N-[(4-tert-butylphenyl)methyl]naphthalene-1-sulfonamide (PubChem CID 69050845) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 5-amino-N-[(4-tert-butylphenyl)methyl]naphthalene-1-sulfonamide.
| Compound Name | 5-amino-N-[(4-tert-butylphenyl)methyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 69050845 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-amino-N-[(4-tert-butylphenyl)methyl]naphthalene-1-sulfonamide |
| SMILES | CC(C)(C)c1ccc(CNS(=O)(=O)c2cccc3c(N)cccc23)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-21(2,3)16-12-10-15(11-13-16)14-23-26(24,25)20-9-5-6-17-18(20)7-4-8-19(17)22/h4-13,23H,14,22H2,1-3H3 |
| InChIKey | CDKCZTMFYJCLOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|