C27H29N3 — CID 69048476
4-[5-[2-(4-tert-butylphenyl)ethenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline (PubChem CID 69048476) has the molecular formula C27H29N3 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[5-[2-(4-tert-butylphenyl)ethenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline.
| Compound Name | 4-[5-[2-(4-tert-butylphenyl)ethenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 69048476 |
| Molecular Formula | C27H29N3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-[5-[2-(4-tert-butylphenyl)ethenyl]-2-phenyl-3,4-dihydropyrazol-3-yl]aniline |
| SMILES | CC(C)(C)c1ccc(C=CC2=NN(c3ccccc3)C(c3ccc(N)cc3)C2)cc1 |
| InChI | InChI=1S/C27H29N3/c1-27(2,3)22-14-9-20(10-15-22)11-18-24-19-26(21-12-16-23(28)17-13-21)30(29-24)25-7-5-4-6-8-25/h4-18,26H,19,28H2,1-3H3 |
| InChIKey | BYJHGDZFDKQINI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|