C14H13I2NO3 — CID 69049001
4-[4-(2-amino-2-hydroxyethyl)-2,6-diiodophenoxy]phenol (PubChem CID 69049001) has the molecular formula C14H13I2NO3 and a molecular weight of 497.07 g/mol. Its IUPAC name is 4-[4-(2-amino-2-hydroxyethyl)-2,6-diiodophenoxy]phenol.
| Compound Name | 4-[4-(2-amino-2-hydroxyethyl)-2,6-diiodophenoxy]phenol |
|---|---|
| PubChem CID | 69049001 |
| Molecular Formula | C14H13I2NO3 |
| Molecular Weight | 497.07 g/mol |
| Exact Mass | 496.90 |
| IUPAC Name | 4-[4-(2-amino-2-hydroxyethyl)-2,6-diiodophenoxy]phenol |
| SMILES | NC(O)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
| InChI | InChI=1S/C14H13I2NO3/c15-11-5-8(7-13(17)19)6-12(16)14(11)20-10-3-1-9(18)2-4-10/h1-6,13,18-19H,7,17H2 |
| InChIKey | HKHDQEZPJWJNQQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.07 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|