About 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol
4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol (PubChem CID 23386461) has the molecular formula C16H16I2O2
and a molecular weight of 494.11 g/mol. Its IUPAC name is 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol.
Molecular Properties
| Compound Name | 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol |
| PubChem CID | 23386461 |
| Molecular Formula | C16H16I2O2 |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 493.92 |
| IUPAC Name | 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol |
| SMILES | CC(C)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
| InChI | InChI=1S/C16H16I2O2/c1-10(2)7-11-8-14(17)16(15(18)9-11)20-13-5-3-12(19)4-6-13/h3-6,8-10,19H,7H2,1-2H3 |
| InChIKey | AUEYERSSENIWDV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol?
The IUPAC name of 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol (CID 23386461) is 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol.
What is the SMILES notation for 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol?
The canonical SMILES for 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol is CC(C)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1.
What is the InChIKey of 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol?
The InChIKey is AUEYERSSENIWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16I2O2/c1-10(2)7-11-8-14(17)16(15(18)9-11)20-13-5-3-12(19)4-6-13/h3-6,8-10,19H,7H2,1-2H3.
What are the key properties of 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol?
4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol has a molecular weight of 494.11 g/mol, XLogP of 5.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-diiodo-4-(2-methylpropyl)phenoxy]phenol is sourced from PubChem (CID 23386461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).