C16H15F3O — CID 178142552
1,3,5-trifluoro-2-[4-(2-methylpropyl)phenoxy]benzene (PubChem CID 178142552) has the molecular formula C16H15F3O and a molecular weight of 280.29 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-[4-(2-methylpropyl)phenoxy]benzene.
| Compound Name | 1,3,5-trifluoro-2-[4-(2-methylpropyl)phenoxy]benzene |
|---|---|
| PubChem CID | 178142552 |
| Molecular Formula | C16H15F3O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1,3,5-trifluoro-2-[4-(2-methylpropyl)phenoxy]benzene |
| SMILES | CC(C)Cc1ccc(Oc2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H15F3O/c1-10(2)7-11-3-5-13(6-4-11)20-16-14(18)8-12(17)9-15(16)19/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | VTHHVIJKZJVXLV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |