5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid

C17H10Cl2N2O2 — CID 69049403

IUPAC5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid
SMILESO=C(O)c1cnc(-c2ccccc2Cl)c(-c2ccccc2Cl)n1
InChIInChI=1S/C17H10Cl2N2O2/c18-12-7-3-1-5-10(12)15-16(11-6-2-4-8-13(11)19)21-14(9-20-15)17(22)23/h1-9H,(H,22,23)
InChIKeyZTJONRNCXSOVQR-UHFFFAOYSA-N
MW345.19 g/mol
LogP4.82
Rot. Bonds3

About 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid

5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid (PubChem CID 69049403) has the molecular formula C17H10Cl2N2O2 and a molecular weight of 345.19 g/mol. Its IUPAC name is 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid
PubChem CID69049403
Molecular FormulaC17H10Cl2N2O2
Molecular Weight345.19 g/mol
Exact Mass344.01
IUPAC Name5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid
SMILESO=C(O)c1cnc(-c2ccccc2Cl)c(-c2ccccc2Cl)n1
InChIInChI=1S/C17H10Cl2N2O2/c18-12-7-3-1-5-10(12)15-16(11-6-2-4-8-13(11)19)21-14(9-20-15)17(22)23/h1-9H,(H,22,23)
InChIKeyZTJONRNCXSOVQR-UHFFFAOYSA-N
XLogP4.82
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.19
LogP ≤ 54.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5,6-Bis-(4-bromophenyl)-pyrazine-2-carboxylic acid
CID 69051372
5-Phenylpyrazine-2-carboxylic acid
CID 13317179
Sodium 6-phenylpyrazine-2-carboxylate
CID 168283430
Sodium 5-phenylpyrazine-2-carboxylate
CID 168295860
5-[3-(1-Pyrrolidin-1-ylethyl)phenyl]pyrazine-2-carboxylic acid
CID 77097061
6-[3-(Morpholin-4-ylmethyl)phenyl]pyrazine-2-carboxylicacid
CID 77093018
5,6-Diphenyl-2-pyrazinecarboxylic acid
CID 10214728
5,6-Bis(4-chlorophenyl)-pyrazine-2-carboxylic acid
CID 58662004
5,6-Bis(4-methylphenyl)pyrazine-2-carboxylic acid
CID 59654098
6-Phenylpyrazine-2-carboxylic acid
CID 13317180
5-[4-(Trifluoromethyl)phenyl]pyrazine-2-carboxylic acid
CID 21935676
5-(4-Fluorophenyl)pyrazine-2-carboxylic acid
CID 23080282

Frequently Asked Questions

What is the IUPAC name of 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid?
The IUPAC name of 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid (CID 69049403) is 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid.
What is the SMILES notation for 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid?
The canonical SMILES for 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid is O=C(O)c1cnc(-c2ccccc2Cl)c(-c2ccccc2Cl)n1.
What is the InChIKey of 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid?
The InChIKey is ZTJONRNCXSOVQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2N2O2/c18-12-7-3-1-5-10(12)15-16(11-6-2-4-8-13(11)19)21-14(9-20-15)17(22)23/h1-9H,(H,22,23).
What are the key properties of 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid?
5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid has a molecular weight of 345.19 g/mol, XLogP of 4.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(2-chlorophenyl)pyrazine-2-carboxylic acid is sourced from PubChem (CID 69049403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).