C13H15N5OS — CID 6905027
N-[4-[(E)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl]acetamide (PubChem CID 6905027) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[4-[(E)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 6905027 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[4-[(E)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl]acetamide |
| SMILES | CCc1n[nH]c(=S)n1/N=C/c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C13H15N5OS/c1-3-12-16-17-13(20)18(12)14-8-10-4-6-11(7-5-10)15-9(2)19/h4-8H,3H2,1-2H3,(H,15,19)(H,17,20)/b14-8+ |
| InChIKey | JCPCWIWLFIQCNI-RIYZIHGNSA-N |
| XLogP | 2.34 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|