C21H15F3N2O3 — CID 69056036
4-cyano-1-methyl-3-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)pyrrole-2-carboxylic acid (PubChem CID 69056036) has the molecular formula C21H15F3N2O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is 4-cyano-1-methyl-3-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-cyano-1-methyl-3-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 69056036 |
| Molecular Formula | C21H15F3N2O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-cyano-1-methyl-3-(4-phenylmethoxyphenyl)-5-(trifluoromethyl)pyrrole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)c(-c2ccc(OCc3ccccc3)cc2)c(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C21H15F3N2O3/c1-26-18(20(27)28)17(16(11-25)19(26)21(22,23)24)14-7-9-15(10-8-14)29-12-13-5-3-2-4-6-13/h2-10H,12H2,1H3,(H,27,28) |
| InChIKey | UNXLCNWURDZAHQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |