C15H16ClF3N4O2 — CID 69056681
2-[(1S)-5-chloro-3-oxo-2-(4,4,4-trifluorobutyl)-1H-isoindol-1-yl]-N-(diaminomethylidene)acetamide (PubChem CID 69056681) has the molecular formula C15H16ClF3N4O2 and a molecular weight of 376.77 g/mol. Its IUPAC name is 2-[(1S)-5-chloro-3-oxo-2-(4,4,4-trifluorobutyl)-1H-isoindol-1-yl]-N-(diaminomethylidene)acetamide.
| Compound Name | 2-[(1S)-5-chloro-3-oxo-2-(4,4,4-trifluorobutyl)-1H-isoindol-1-yl]-N-(diaminomethylidene)acetamide |
|---|---|
| PubChem CID | 69056681 |
| Molecular Formula | C15H16ClF3N4O2 |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[(1S)-5-chloro-3-oxo-2-(4,4,4-trifluorobutyl)-1H-isoindol-1-yl]-N-(diaminomethylidene)acetamide |
| SMILES | NC(N)=NC(=O)C[C@H]1c2ccc(Cl)cc2C(=O)N1CCCC(F)(F)F |
| InChI | InChI=1S/C15H16ClF3N4O2/c16-8-2-3-9-10(6-8)13(25)23(5-1-4-15(17,18)19)11(9)7-12(24)22-14(20)21/h2-3,6,11H,1,4-5,7H2,(H4,20,21,22,24)/t11-/m0/s1 |
| InChIKey | QJELXFOTUYLTBZ-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|