C8H11NO5 — CID 69059915
2-(2-carboxyacetyl)pyrrolidine-1-carboxylic acid (PubChem CID 69059915) has the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. Its IUPAC name is 2-(2-carboxyacetyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-(2-carboxyacetyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69059915 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(2-carboxyacetyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)CC(=O)C1CCCN1C(=O)O |
| InChI | InChI=1S/C8H11NO5/c10-6(4-7(11)12)5-2-1-3-9(5)8(13)14/h5H,1-4H2,(H,11,12)(H,13,14) |
| InChIKey | KAJGZYGIFFYFLS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|