C10H16N2O3 — CID 121437087
(2S)-2-(but-3-enylcarbamoyl)pyrrolidine-1-carboxylic acid (PubChem CID 121437087) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is (2S)-2-(but-3-enylcarbamoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-(but-3-enylcarbamoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 121437087 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2S)-2-(but-3-enylcarbamoyl)pyrrolidine-1-carboxylic acid |
| SMILES | C=CCCNC(=O)[C@@H]1CCCN1C(=O)O |
| InChI | InChI=1S/C10H16N2O3/c1-2-3-6-11-9(13)8-5-4-7-12(8)10(14)15/h2,8H,1,3-7H2,(H,11,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | GMSZBPXUUSEOLI-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|