C15H10F3N3O2 — CID 69060257
4-pyridin-4-yl-3-[3-(trifluoromethoxy)phenyl]-1,2-oxazol-5-amine (PubChem CID 69060257) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-pyridin-4-yl-3-[3-(trifluoromethoxy)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-pyridin-4-yl-3-[3-(trifluoromethoxy)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 69060257 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-pyridin-4-yl-3-[3-(trifluoromethoxy)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2cccc(OC(F)(F)F)c2)c1-c1ccncc1 |
| InChI | InChI=1S/C15H10F3N3O2/c16-15(17,18)22-11-3-1-2-10(8-11)13-12(14(19)23-21-13)9-4-6-20-7-5-9/h1-8H,19H2 |
| InChIKey | ZAPDNNOHBCIWFH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |