C25H25N7O — CID 69062550
9-[2-(2-amino-3-ethylanilino)pyrimidin-4-yl]-2-phenyl-7,8-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one (PubChem CID 69062550) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is 9-[2-(2-amino-3-ethylanilino)pyrimidin-4-yl]-2-phenyl-7,8-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-[2-(2-amino-3-ethylanilino)pyrimidin-4-yl]-2-phenyl-7,8-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 69062550 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 9-[2-(2-amino-3-ethylanilino)pyrimidin-4-yl]-2-phenyl-7,8-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1cccc(Nc2nccc(N3CCCn4c3nc(-c3ccccc3)cc4=O)n2)c1N |
| InChI | InChI=1S/C25H25N7O/c1-2-17-10-6-11-19(23(17)26)28-24-27-13-12-21(30-24)31-14-7-15-32-22(33)16-20(29-25(31)32)18-8-4-3-5-9-18/h3-6,8-13,16H,2,7,14-15,26H2,1H3,(H,27,28,30) |
| InChIKey | JUYJXCSTFHMHFW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|