C17H19ClN2Si — CID 69065016
[5-(4-chlorophenyl)-2-(2-trimethylsilylethynyl)-3-pyridinyl]methanamine (PubChem CID 69065016) has the molecular formula C17H19ClN2Si and a molecular weight of 314.89 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-2-(2-trimethylsilylethynyl)-3-pyridinyl]methanamine.
| Compound Name | [5-(4-chlorophenyl)-2-(2-trimethylsilylethynyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 69065016 |
| Molecular Formula | C17H19ClN2Si |
| Molecular Weight | 314.89 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [5-(4-chlorophenyl)-2-(2-trimethylsilylethynyl)-3-pyridinyl]methanamine |
| SMILES | C[Si](C)(C)C#Cc1ncc(-c2ccc(Cl)cc2)cc1CN |
| InChI | InChI=1S/C17H19ClN2Si/c1-21(2,3)9-8-17-14(11-19)10-15(12-20-17)13-4-6-16(18)7-5-13/h4-7,10,12H,11,19H2,1-3H3 |
| InChIKey | QIXQFRCCLCLUSB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|