About 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine
2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine (PubChem CID 69068331) has the molecular formula C20H29FN2O7
and a molecular weight of 428.46 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine |
| PubChem CID | 69068331 |
| Molecular Formula | C20H29FN2O7 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine |
| SMILES | Fc1ccc(CN(C2CCOCC2)[C@H]2CCNC2)cc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C16H23FN2O.C4H6O6/c17-14-3-1-13(2-4-14)12-19(16-5-8-18-11-16)15-6-9-20-10-7-15;5-1(3(7)8)2(6)4(9)10/h1-4,15-16,18H,5-12H2;1-2,5-6H,(H,7,8)(H,9,10)/t16-;/m0./s1 |
| InChIKey | FEWARFRLBRAIRR-NTISSMGPSA-N |
| XLogP | 0.05 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine?
The IUPAC name of 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine (CID 69068331) is 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine.
What is the SMILES notation for 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine?
The canonical SMILES for 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine is Fc1ccc(CN(C2CCOCC2)[C@H]2CCNC2)cc1.O=C(O)C(O)C(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine?
The InChIKey is FEWARFRLBRAIRR-NTISSMGPSA-N. The full InChI is InChI=1S/C16H23FN2O.C4H6O6/c17-14-3-1-13(2-4-14)12-19(16-5-8-18-11-16)15-6-9-20-10-7-15;5-1(3(7)8)2(6)4(9)10/h1-4,15-16,18H,5-12H2;1-2,5-6H,(H,7,8)(H,9,10)/t16-;/m0./s1.
What are the key properties of 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine?
2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine has a molecular weight of 428.46 g/mol, XLogP of 0.05, 7 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxybutanedioic acid;(3S)-N-[(4-fluorophenyl)methyl]-N-(oxan-4-yl)pyrrolidin-3-amine is sourced from PubChem (CID 69068331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).