C20H19Cl2FN4O2 — CID 69070605
4-[(2,5-dichlorophenoxy)methyl]-N-[1-(4-fluorobutyl)pyrazol-4-yl]pyridine-2-carboxamide (PubChem CID 69070605) has the molecular formula C20H19Cl2FN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenoxy)methyl]-N-[1-(4-fluorobutyl)pyrazol-4-yl]pyridine-2-carboxamide.
| Compound Name | 4-[(2,5-dichlorophenoxy)methyl]-N-[1-(4-fluorobutyl)pyrazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 69070605 |
| Molecular Formula | C20H19Cl2FN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 4-[(2,5-dichlorophenoxy)methyl]-N-[1-(4-fluorobutyl)pyrazol-4-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cnn(CCCCF)c1)c1cc(COc2cc(Cl)ccc2Cl)ccn1 |
| InChI | InChI=1S/C20H19Cl2FN4O2/c21-15-3-4-17(22)19(10-15)29-13-14-5-7-24-18(9-14)20(28)26-16-11-25-27(12-16)8-2-1-6-23/h3-5,7,9-12H,1-2,6,8,13H2,(H,26,28) |
| InChIKey | OWGLKDLDURZATH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|