About CID 69077180
CID 69077180 (PubChem CID 69077180) has the molecular formula C16H18BO2S2
and a molecular weight of 317.26 g/mol.
Molecular Properties
| Compound Name | CID 69077180 |
| PubChem CID | 69077180 |
| Molecular Formula | C16H18BO2S2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | — |
| SMILES | CCSc1ccc(O[B]Oc2ccc(SCC)cc2)cc1 |
| InChI | InChI=1S/C16H18BO2S2/c1-3-20-15-9-5-13(6-10-15)18-17-19-14-7-11-16(12-8-14)21-4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | YNXAIOSDUAGLCK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69077180 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69077180?
The IUPAC name of CID 69077180 (CID 69077180) is not available.
What is the SMILES notation for CID 69077180?
The canonical SMILES for CID 69077180 is CCSc1ccc(O[B]Oc2ccc(SCC)cc2)cc1.
What is the InChIKey of CID 69077180?
The InChIKey is YNXAIOSDUAGLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BO2S2/c1-3-20-15-9-5-13(6-10-15)18-17-19-14-7-11-16(12-8-14)21-4-2/h5-12H,3-4H2,1-2H3.
What are the key properties of CID 69077180?
CID 69077180 has a molecular weight of 317.26 g/mol, XLogP of 4.90, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69077180 is sourced from PubChem (CID 69077180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).