C25H36N2O5S — CID 69082954
N-[[1-(2,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]methyl]adamantane-1-carboxamide (PubChem CID 69082954) has the molecular formula C25H36N2O5S and a molecular weight of 476.64 g/mol. Its IUPAC name is N-[[1-(2,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[1-(2,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 69082954 |
| Molecular Formula | C25H36N2O5S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[[1-(2,4-dimethoxyphenyl)sulfonylpiperidin-2-yl]methyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2CNC(=O)C23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C25H36N2O5S/c1-31-21-6-7-23(22(12-21)32-2)33(29,30)27-8-4-3-5-20(27)16-26-24(28)25-13-17-9-18(14-25)11-19(10-17)15-25/h6-7,12,17-20H,3-5,8-11,13-16H2,1-2H3,(H,26,28) |
| InChIKey | JZSVUMQHXVFTAA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |