C26H23FN2O2 — CID 69085086
1-(2-ethylphenyl)-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrrole-2-carboxamide (PubChem CID 69085086) has the molecular formula C26H23FN2O2 and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrrole-2-carboxamide.
| Compound Name | 1-(2-ethylphenyl)-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 69085086 |
| Molecular Formula | C26H23FN2O2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-(2-ethylphenyl)-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrrole-2-carboxamide |
| SMILES | CCc1ccccc1-n1cccc1C(=O)NCc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H23FN2O2/c1-2-20-6-3-4-7-24(20)29-17-5-8-25(29)26(30)28-18-19-9-13-22(14-10-19)31-23-15-11-21(27)12-16-23/h3-17H,2,18H2,1H3,(H,28,30) |
| InChIKey | RADPNXYFVVQRSI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |