C14H12N2O4S — CID 6908575
2-[(E)-(benzenesulfonylhydrazinylidene)methyl]benzoic acid (PubChem CID 6908575) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-[(E)-(benzenesulfonylhydrazinylidene)methyl]benzoic acid.
| Compound Name | 2-[(E)-(benzenesulfonylhydrazinylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 6908575 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[(E)-(benzenesulfonylhydrazinylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/C=N/NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O4S/c17-14(18)13-9-5-4-6-11(13)10-15-16-21(19,20)12-7-2-1-3-8-12/h1-10,16H,(H,17,18)/b15-10+ |
| InChIKey | APKRKKKZAMSNQA-XNTDXEJSSA-N |
| XLogP | 1.70 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|